C13H15N3O4S — CID 62116326
methyl 2-[(1-methylpyrazol-4-yl)sulfonylamino]-2-phenylacetate (PubChem CID 62116326) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is methyl 2-[(1-methylpyrazol-4-yl)sulfonylamino]-2-phenylacetate.
| Compound Name | methyl 2-[(1-methylpyrazol-4-yl)sulfonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 62116326 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | methyl 2-[(1-methylpyrazol-4-yl)sulfonylamino]-2-phenylacetate |
| SMILES | COC(=O)C(NS(=O)(=O)c1cnn(C)c1)c1ccccc1 |
| InChI | InChI=1S/C13H15N3O4S/c1-16-9-11(8-14-16)21(18,19)15-12(13(17)20-2)10-6-4-3-5-7-10/h3-9,12,15H,1-2H3 |
| InChIKey | CHBNZJSAEXERGQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |