C12H16N4O4S2 — CID 55903082
1-methyl-N-[1-(3-sulfamoylphenyl)ethyl]pyrazole-4-sulfonamide (PubChem CID 55903082) has the molecular formula C12H16N4O4S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-methyl-N-[1-(3-sulfamoylphenyl)ethyl]pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-[1-(3-sulfamoylphenyl)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 55903082 |
| Molecular Formula | C12H16N4O4S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1-methyl-N-[1-(3-sulfamoylphenyl)ethyl]pyrazole-4-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cnn(C)c1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H16N4O4S2/c1-9(10-4-3-5-11(6-10)21(13,17)18)15-22(19,20)12-7-14-16(2)8-12/h3-9,15H,1-2H3,(H2,13,17,18) |
| InChIKey | ZCDTVZIIGRYSHH-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |