C18H24N2O4S2 — CID 51249257
2,3,5,6-tetramethyl-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide (PubChem CID 51249257) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2,3,5,6-tetramethyl-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51249257 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 2,3,5,6-tetramethyl-N-[1-(3-sulfamoylphenyl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NC(C)c2cccc(S(N)(=O)=O)c2)c1C |
| InChI | InChI=1S/C18H24N2O4S2/c1-11-9-12(2)14(4)18(13(11)3)26(23,24)20-15(5)16-7-6-8-17(10-16)25(19,21)22/h6-10,15,20H,1-5H3,(H2,19,21,22) |
| InChIKey | YXVUJEKROCZVIP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |