C18H23NO2S — CID 19680818
2,3,5,6-tetramethyl-N-(1-phenylethyl)benzenesulfonamide (PubChem CID 19680818) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N-(1-phenylethyl)benzenesulfonamide.
| Compound Name | 2,3,5,6-tetramethyl-N-(1-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 19680818 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2,3,5,6-tetramethyl-N-(1-phenylethyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NC(C)c2ccccc2)c1C |
| InChI | InChI=1S/C18H23NO2S/c1-12-11-13(2)15(4)18(14(12)3)22(20,21)19-16(5)17-9-7-6-8-10-17/h6-11,16,19H,1-5H3 |
| InChIKey | LSTODLBTWLMOJS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |