C13H21NO2S — CID 6463266
2,3,5,6-tetramethyl-N-propan-2-ylbenzenesulfonamide (PubChem CID 6463266) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2,3,5,6-tetramethyl-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 6463266 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2,3,5,6-tetramethyl-N-propan-2-ylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NC(C)C)c1C |
| InChI | InChI=1S/C13H21NO2S/c1-8(2)14-17(15,16)13-11(5)9(3)7-10(4)12(13)6/h7-8,14H,1-6H3 |
| InChIKey | CEGPRJBGXUBALT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |