C11H18BNO4S — CID 91759493
[3,5-dimethyl-4-(propan-2-ylsulfamoyl)phenyl]boronic acid (PubChem CID 91759493) has the molecular formula C11H18BNO4S and a molecular weight of 271.15 g/mol. Its IUPAC name is [3,5-dimethyl-4-(propan-2-ylsulfamoyl)phenyl]boronic acid.
| Compound Name | [3,5-dimethyl-4-(propan-2-ylsulfamoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 91759493 |
| Molecular Formula | C11H18BNO4S |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [3,5-dimethyl-4-(propan-2-ylsulfamoyl)phenyl]boronic acid |
| SMILES | Cc1cc(B(O)O)cc(C)c1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C11H18BNO4S/c1-7(2)13-18(16,17)11-8(3)5-10(12(14)15)6-9(11)4/h5-7,13-15H,1-4H3 |
| InChIKey | FMJRLYQOGPUFJU-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|