C12H20N2O2S — CID 68919996
N-[(2S)-1-aminopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 68919996) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 68919996 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@@H](C)CN)c(C)c1 |
| InChI | InChI=1S/C12H20N2O2S/c1-8-5-9(2)12(10(3)6-8)17(15,16)14-11(4)7-13/h5-6,11,14H,7,13H2,1-4H3/t11-/m0/s1 |
| InChIKey | ZEHCKRLZHQEKNE-NSHDSACASA-N |
| XLogP | 1.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |