C21H29NO5S2 — CID 86629199
[(2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 86629199) has the molecular formula C21H29NO5S2 and a molecular weight of 439.60 g/mol. Its IUPAC name is [(2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [(2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 86629199 |
| Molecular Formula | C21H29NO5S2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [(2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@@H](C)COS(=O)(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H29NO5S2/c1-13-8-15(3)20(16(4)9-13)28(23,24)22-19(7)12-27-29(25,26)21-17(5)10-14(2)11-18(21)6/h8-11,19,22H,12H2,1-7H3/t19-/m0/s1 |
| InChIKey | YFTNWJHPCKWMOX-IBGZPJMESA-N |
| XLogP | 3.61 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|