C19H23ClN2O4S — CID 76583533
4-chloro-2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]propoxy]benzamide (PubChem CID 76583533) has the molecular formula C19H23ClN2O4S and a molecular weight of 410.92 g/mol. Its IUPAC name is 4-chloro-2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]propoxy]benzamide.
| Compound Name | 4-chloro-2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]propoxy]benzamide |
|---|---|
| PubChem CID | 76583533 |
| Molecular Formula | C19H23ClN2O4S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 4-chloro-2-[2-[(2,4,6-trimethylphenyl)sulfonylamino]propoxy]benzamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC(C)COc2cc(Cl)ccc2C(N)=O)c(C)c1 |
| InChI | InChI=1S/C19H23ClN2O4S/c1-11-7-12(2)18(13(3)8-11)27(24,25)22-14(4)10-26-17-9-15(20)5-6-16(17)19(21)23/h5-9,14,22H,10H2,1-4H3,(H2,21,23) |
| InChIKey | AJJFWRKYRXOUBA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |