C16H21NO2S2 — CID 43001325
2,3,5,6-tetramethyl-N-(1-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 43001325) has the molecular formula C16H21NO2S2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N-(1-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 2,3,5,6-tetramethyl-N-(1-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43001325 |
| Molecular Formula | C16H21NO2S2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2,3,5,6-tetramethyl-N-(1-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NC(C)c2cccs2)c1C |
| InChI | InChI=1S/C16H21NO2S2/c1-10-9-11(2)13(4)16(12(10)3)21(18,19)17-14(5)15-7-6-8-20-15/h6-9,14,17H,1-5H3 |
| InChIKey | MLCJGMFMBCIUFE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |