C13H11F4NO3S2 — CID 18191910
2,3,5,6-tetrafluoro-4-methoxy-N-(1-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 18191910) has the molecular formula C13H11F4NO3S2 and a molecular weight of 369.36 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-(1-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-(1-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18191910 |
| Molecular Formula | C13H11F4NO3S2 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-(1-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | COc1c(F)c(F)c(S(=O)(=O)NC(C)c2cccs2)c(F)c1F |
| InChI | InChI=1S/C13H11F4NO3S2/c1-6(7-4-3-5-22-7)18-23(19,20)13-10(16)8(14)12(21-2)9(15)11(13)17/h3-6,18H,1-2H3 |
| InChIKey | RXLHUSSSWAUCDV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|