C14H12F4N2O3S — CID 18194304
2,3,5,6-tetrafluoro-4-methoxy-N-(1-pyridin-3-ylethyl)benzenesulfonamide (PubChem CID 18194304) has the molecular formula C14H12F4N2O3S and a molecular weight of 364.32 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-(1-pyridin-3-ylethyl)benzenesulfonamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-(1-pyridin-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18194304 |
| Molecular Formula | C14H12F4N2O3S |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-(1-pyridin-3-ylethyl)benzenesulfonamide |
| SMILES | COc1c(F)c(F)c(S(=O)(=O)NC(C)c2cccnc2)c(F)c1F |
| InChI | InChI=1S/C14H12F4N2O3S/c1-7(8-4-3-5-19-6-8)20-24(21,22)14-11(17)9(15)13(23-2)10(16)12(14)18/h3-7,20H,1-2H3 |
| InChIKey | VRIDAWJKUDYXOU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|