C12H16N4O2S — CID 43397195
3,5-dimethyl-N-(1-pyridin-3-ylethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 43397195) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 3,5-dimethyl-N-(1-pyridin-3-ylethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-(1-pyridin-3-ylethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 43397195 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 3,5-dimethyl-N-(1-pyridin-3-ylethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NC(C)c1cccnc1 |
| InChI | InChI=1S/C12H16N4O2S/c1-8(11-5-4-6-13-7-11)16-19(17,18)12-9(2)14-15-10(12)3/h4-8,16H,1-3H3,(H,14,15) |
| InChIKey | VYCLSEFZYFAUMN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |