C12H14N4O4S — CID 81394759
5-methyl-4-[[(1S)-1-pyridin-4-ylethyl]sulfamoyl]-1H-pyrazole-3-carboxylic acid (PubChem CID 81394759) has the molecular formula C12H14N4O4S and a molecular weight of 310.33 g/mol. Its IUPAC name is 5-methyl-4-[[(1S)-1-pyridin-4-ylethyl]sulfamoyl]-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-methyl-4-[[(1S)-1-pyridin-4-ylethyl]sulfamoyl]-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 81394759 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-methyl-4-[[(1S)-1-pyridin-4-ylethyl]sulfamoyl]-1H-pyrazole-3-carboxylic acid |
| SMILES | Cc1[nH]nc(C(=O)O)c1S(=O)(=O)N[C@@H](C)c1ccncc1 |
| InChI | InChI=1S/C12H14N4O4S/c1-7(9-3-5-13-6-4-9)16-21(19,20)11-8(2)14-15-10(11)12(17)18/h3-7,16H,1-2H3,(H,14,15)(H,17,18)/t7-/m0/s1 |
| InChIKey | OIRQZFUKESHPIQ-ZETCQYMHSA-N |
| XLogP | 0.85 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |