C11H9BrFN3O4S — CID 107624884
4-[(2-bromo-5-fluorophenyl)sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid (PubChem CID 107624884) has the molecular formula C11H9BrFN3O4S and a molecular weight of 378.18 g/mol. Its IUPAC name is 4-[(2-bromo-5-fluorophenyl)sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid.
| Compound Name | 4-[(2-bromo-5-fluorophenyl)sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107624884 |
| Molecular Formula | C11H9BrFN3O4S |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | 4-[(2-bromo-5-fluorophenyl)sulfamoyl]-5-methyl-1H-pyrazole-3-carboxylic acid |
| SMILES | Cc1[nH]nc(C(=O)O)c1S(=O)(=O)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C11H9BrFN3O4S/c1-5-10(9(11(17)18)15-14-5)21(19,20)16-8-4-6(13)2-3-7(8)12/h2-4,16H,1H3,(H,14,15)(H,17,18) |
| InChIKey | APWIQHWFMREIOB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |