C12H8Br3FN2O2S — CID 107624697
2-amino-4,6-dibromo-N-(2-bromo-5-fluorophenyl)benzenesulfonamide (PubChem CID 107624697) has the molecular formula C12H8Br3FN2O2S and a molecular weight of 502.99 g/mol. Its IUPAC name is 2-amino-4,6-dibromo-N-(2-bromo-5-fluorophenyl)benzenesulfonamide.
| Compound Name | 2-amino-4,6-dibromo-N-(2-bromo-5-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107624697 |
| Molecular Formula | C12H8Br3FN2O2S |
| Molecular Weight | 502.99 g/mol |
| Exact Mass | 499.78 |
| IUPAC Name | 2-amino-4,6-dibromo-N-(2-bromo-5-fluorophenyl)benzenesulfonamide |
| SMILES | Nc1cc(Br)cc(Br)c1S(=O)(=O)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C12H8Br3FN2O2S/c13-6-3-9(15)12(10(17)4-6)21(19,20)18-11-5-7(16)1-2-8(11)14/h1-5,18H,17H2 |
| InChIKey | PQUIQSYYNPBGEU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.99 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|