C11H9BrFN3O2S — CID 107630755
4-amino-N-(2-bromo-5-fluorophenyl)pyridine-3-sulfonamide (PubChem CID 107630755) has the molecular formula C11H9BrFN3O2S and a molecular weight of 346.18 g/mol. Its IUPAC name is 4-amino-N-(2-bromo-5-fluorophenyl)pyridine-3-sulfonamide.
| Compound Name | 4-amino-N-(2-bromo-5-fluorophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107630755 |
| Molecular Formula | C11H9BrFN3O2S |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 4-amino-N-(2-bromo-5-fluorophenyl)pyridine-3-sulfonamide |
| SMILES | Nc1ccncc1S(=O)(=O)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C11H9BrFN3O2S/c12-8-2-1-7(13)5-10(8)16-19(17,18)11-6-15-4-3-9(11)14/h1-6,16H,(H2,14,15) |
| InChIKey | NWZQXTLCIGRYKY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |