C12H7BrF3NO2S — CID 103752869
N-(2-bromo-5-fluorophenyl)-2,5-difluorobenzenesulfonamide (PubChem CID 103752869) has the molecular formula C12H7BrF3NO2S and a molecular weight of 366.16 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)-2,5-difluorobenzenesulfonamide.
| Compound Name | N-(2-bromo-5-fluorophenyl)-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103752869 |
| Molecular Formula | C12H7BrF3NO2S |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 364.93 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)-2,5-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)ccc1Br)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H7BrF3NO2S/c13-9-3-1-7(14)5-11(9)17-20(18,19)12-6-8(15)2-4-10(12)16/h1-6,17H |
| InChIKey | VQIRJTCRQUFXJB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |