C12H7BrF3NO2S — CID 97455684
4-bromo-N-(2,5-difluorophenyl)-2-fluorobenzenesulfonamide (PubChem CID 97455684) has the molecular formula C12H7BrF3NO2S and a molecular weight of 366.16 g/mol. Its IUPAC name is 4-bromo-N-(2,5-difluorophenyl)-2-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(2,5-difluorophenyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 97455684 |
| Molecular Formula | C12H7BrF3NO2S |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 364.93 |
| IUPAC Name | 4-bromo-N-(2,5-difluorophenyl)-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)ccc1F)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H7BrF3NO2S/c13-7-1-4-12(10(16)5-7)20(18,19)17-11-6-8(14)2-3-9(11)15/h1-6,17H |
| InChIKey | XSRUZXCUJJHTAE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |