C12H6BrF4NO2S — CID 116528581
4-bromo-2-fluoro-N-(2,3,5-trifluorophenyl)benzenesulfonamide (PubChem CID 116528581) has the molecular formula C12H6BrF4NO2S and a molecular weight of 384.15 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-(2,3,5-trifluorophenyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-fluoro-N-(2,3,5-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 116528581 |
| Molecular Formula | C12H6BrF4NO2S |
| Molecular Weight | 384.15 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | 4-bromo-2-fluoro-N-(2,3,5-trifluorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)cc(F)c1F)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H6BrF4NO2S/c13-6-1-2-11(8(15)3-6)21(19,20)18-10-5-7(14)4-9(16)12(10)17/h1-5,18H |
| InChIKey | SCEOOGFUGJHKCG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.15 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|