C12H9Br2FN2O2S — CID 61466695
5-amino-N-(2,5-dibromophenyl)-2-fluorobenzenesulfonamide (PubChem CID 61466695) has the molecular formula C12H9Br2FN2O2S and a molecular weight of 424.09 g/mol. Its IUPAC name is 5-amino-N-(2,5-dibromophenyl)-2-fluorobenzenesulfonamide.
| Compound Name | 5-amino-N-(2,5-dibromophenyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 61466695 |
| Molecular Formula | C12H9Br2FN2O2S |
| Molecular Weight | 424.09 g/mol |
| Exact Mass | 421.87 |
| IUPAC Name | 5-amino-N-(2,5-dibromophenyl)-2-fluorobenzenesulfonamide |
| SMILES | Nc1ccc(F)c(S(=O)(=O)Nc2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C12H9Br2FN2O2S/c13-7-1-3-9(14)11(5-7)17-20(18,19)12-6-8(16)2-4-10(12)15/h1-6,17H,16H2 |
| InChIKey | BCIFBVQWSTXIJP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.09 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|