C12H14N4O4S — CID 114698510
5-methyl-4-[(3-methyl-4-pyridinyl)methylsulfamoyl]-1H-pyrazole-3-carboxylic acid (PubChem CID 114698510) has the molecular formula C12H14N4O4S and a molecular weight of 310.33 g/mol. Its IUPAC name is 5-methyl-4-[(3-methyl-4-pyridinyl)methylsulfamoyl]-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-methyl-4-[(3-methyl-4-pyridinyl)methylsulfamoyl]-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 114698510 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-methyl-4-[(3-methyl-4-pyridinyl)methylsulfamoyl]-1H-pyrazole-3-carboxylic acid |
| SMILES | Cc1cnccc1CNS(=O)(=O)c1c(C(=O)O)n[nH]c1C |
| InChI | InChI=1S/C12H14N4O4S/c1-7-5-13-4-3-9(7)6-14-21(19,20)11-8(2)15-16-10(11)12(17)18/h3-5,14H,6H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | PIUPWTCWEDIVKL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |