C16H20N2O2S — CID 71954745
2,4,5-trimethyl-N-(1-pyridin-3-ylethyl)benzenesulfonamide (PubChem CID 71954745) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 2,4,5-trimethyl-N-(1-pyridin-3-ylethyl)benzenesulfonamide.
| Compound Name | 2,4,5-trimethyl-N-(1-pyridin-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71954745 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2,4,5-trimethyl-N-(1-pyridin-3-ylethyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC(C)c2cccnc2)cc1C |
| InChI | InChI=1S/C16H20N2O2S/c1-11-8-13(3)16(9-12(11)2)21(19,20)18-14(4)15-6-5-7-17-10-15/h5-10,14,18H,1-4H3 |
| InChIKey | YAVULVLYCCURGN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |