C13H12Cl2N2O2S — CID 40673104
2,3-dichloro-N-[(1R)-1-pyridin-3-ylethyl]benzenesulfonamide (PubChem CID 40673104) has the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.22 g/mol. Its IUPAC name is 2,3-dichloro-N-[(1R)-1-pyridin-3-ylethyl]benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[(1R)-1-pyridin-3-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 40673104 |
| Molecular Formula | C13H12Cl2N2O2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2,3-dichloro-N-[(1R)-1-pyridin-3-ylethyl]benzenesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cccc(Cl)c1Cl)c1cccnc1 |
| InChI | InChI=1S/C13H12Cl2N2O2S/c1-9(10-4-3-7-16-8-10)17-20(18,19)12-6-2-5-11(14)13(12)15/h2-9,17H,1H3/t9-/m1/s1 |
| InChIKey | IUTDRQJEUVTMSX-SECBINFHSA-N |
| XLogP | 3.43 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |