C15H17FN2O4S — CID 35312001
2-fluoro-4,5-dimethoxy-N-[(1S)-1-pyridin-3-ylethyl]benzenesulfonamide (PubChem CID 35312001) has the molecular formula C15H17FN2O4S and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-fluoro-4,5-dimethoxy-N-[(1S)-1-pyridin-3-ylethyl]benzenesulfonamide.
| Compound Name | 2-fluoro-4,5-dimethoxy-N-[(1S)-1-pyridin-3-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35312001 |
| Molecular Formula | C15H17FN2O4S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-fluoro-4,5-dimethoxy-N-[(1S)-1-pyridin-3-ylethyl]benzenesulfonamide |
| SMILES | COc1cc(F)c(S(=O)(=O)N[C@@H](C)c2cccnc2)cc1OC |
| InChI | InChI=1S/C15H17FN2O4S/c1-10(11-5-4-6-17-9-11)18-23(19,20)15-8-14(22-3)13(21-2)7-12(15)16/h4-10,18H,1-3H3/t10-/m0/s1 |
| InChIKey | TZGITIUIXPNIAX-JTQLQIEISA-N |
| XLogP | 2.28 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |