C12H10BrCl2NO2S2 — CID 43001330
4-bromo-2,6-dichloro-N-(1-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 43001330) has the molecular formula C12H10BrCl2NO2S2 and a molecular weight of 415.16 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(1-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(1-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43001330 |
| Molecular Formula | C12H10BrCl2NO2S2 |
| Molecular Weight | 415.16 g/mol |
| Exact Mass | 412.87 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(1-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1c(Cl)cc(Br)cc1Cl)c1cccs1 |
| InChI | InChI=1S/C12H10BrCl2NO2S2/c1-7(11-3-2-4-19-11)16-20(17,18)12-9(14)5-8(13)6-10(12)15/h2-7,16H,1H3 |
| InChIKey | QVULHONTBLNRQZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.16 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |