C12H11Br2NO2S2 — CID 43001328
2,5-dibromo-N-(1-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 43001328) has the molecular formula C12H11Br2NO2S2 and a molecular weight of 425.17 g/mol. Its IUPAC name is 2,5-dibromo-N-(1-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(1-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43001328 |
| Molecular Formula | C12H11Br2NO2S2 |
| Molecular Weight | 425.17 g/mol |
| Exact Mass | 422.86 |
| IUPAC Name | 2,5-dibromo-N-(1-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(Br)ccc1Br)c1cccs1 |
| InChI | InChI=1S/C12H11Br2NO2S2/c1-8(11-3-2-6-18-11)15-19(16,17)12-7-9(13)4-5-10(12)14/h2-8,15H,1H3 |
| InChIKey | HJQXUKWZJVPVLG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.17 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |