C14H15Br2NO2S2 — CID 63420561
2,5-dibromo-N-(1-thiophen-2-ylbutyl)benzenesulfonamide (PubChem CID 63420561) has the molecular formula C14H15Br2NO2S2 and a molecular weight of 453.22 g/mol. Its IUPAC name is 2,5-dibromo-N-(1-thiophen-2-ylbutyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(1-thiophen-2-ylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63420561 |
| Molecular Formula | C14H15Br2NO2S2 |
| Molecular Weight | 453.22 g/mol |
| Exact Mass | 450.89 |
| IUPAC Name | 2,5-dibromo-N-(1-thiophen-2-ylbutyl)benzenesulfonamide |
| SMILES | CCCC(NS(=O)(=O)c1cc(Br)ccc1Br)c1cccs1 |
| InChI | InChI=1S/C14H15Br2NO2S2/c1-2-4-12(13-5-3-8-20-13)17-21(18,19)14-9-10(15)6-7-11(14)16/h3,5-9,12,17H,2,4H2,1H3 |
| InChIKey | VLRWTZOGJXCFRC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.22 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |