C17H21BrN2O3S2 — CID 4146621
3-[(4-bromophenyl)sulfonylamino]-N-butyl-3-thiophen-2-ylpropanamide (PubChem CID 4146621) has the molecular formula C17H21BrN2O3S2 and a molecular weight of 445.40 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-butyl-3-thiophen-2-ylpropanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-butyl-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 4146621 |
| Molecular Formula | C17H21BrN2O3S2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-butyl-3-thiophen-2-ylpropanamide |
| SMILES | CCCCNC(=O)CC(NS(=O)(=O)c1ccc(Br)cc1)c1cccs1 |
| InChI | InChI=1S/C17H21BrN2O3S2/c1-2-3-10-19-17(21)12-15(16-5-4-11-24-16)20-25(22,23)14-8-6-13(18)7-9-14/h4-9,11,15,20H,2-3,10,12H2,1H3,(H,19,21) |
| InChIKey | JLIZNXJSOQSIMS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|