C19H25BrN2O4S — CID 4146613
3-[(4-bromophenyl)sulfonylamino]-3-(furan-2-yl)-N-hexylpropanamide (PubChem CID 4146613) has the molecular formula C19H25BrN2O4S and a molecular weight of 457.39 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-3-(furan-2-yl)-N-hexylpropanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-3-(furan-2-yl)-N-hexylpropanamide |
|---|---|
| PubChem CID | 4146613 |
| Molecular Formula | C19H25BrN2O4S |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-3-(furan-2-yl)-N-hexylpropanamide |
| SMILES | CCCCCCNC(=O)CC(NS(=O)(=O)c1ccc(Br)cc1)c1ccco1 |
| InChI | InChI=1S/C19H25BrN2O4S/c1-2-3-4-5-12-21-19(23)14-17(18-7-6-13-26-18)22-27(24,25)16-10-8-15(20)9-11-16/h6-11,13,17,22H,2-5,12,14H2,1H3,(H,21,23) |
| InChIKey | VZGLDMSSKOWQNF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|