C25H36N2O4S — CID 46371459
3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-N-octylpropanamide (PubChem CID 46371459) has the molecular formula C25H36N2O4S and a molecular weight of 460.64 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-N-octylpropanamide.
| Compound Name | 3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-N-octylpropanamide |
|---|---|
| PubChem CID | 46371459 |
| Molecular Formula | C25H36N2O4S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-N-octylpropanamide |
| SMILES | CCCCCCCCNC(=O)CC(NS(=O)(=O)c1ccc(C)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H36N2O4S/c1-4-5-6-7-8-9-18-26-25(28)19-24(21-12-14-22(31-3)15-13-21)27-32(29,30)23-16-10-20(2)11-17-23/h10-17,24,27H,4-9,18-19H2,1-3H3,(H,26,28) |
| InChIKey | NOCBPJFHNGUYQK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|