C21H30N2O4S — CID 98230566
(3R)-3-(furan-2-yl)-N-heptyl-3-[(4-methylphenyl)sulfonylamino]propanamide (PubChem CID 98230566) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is (3R)-3-(furan-2-yl)-N-heptyl-3-[(4-methylphenyl)sulfonylamino]propanamide.
| Compound Name | (3R)-3-(furan-2-yl)-N-heptyl-3-[(4-methylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 98230566 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (3R)-3-(furan-2-yl)-N-heptyl-3-[(4-methylphenyl)sulfonylamino]propanamide |
| SMILES | CCCCCCCNC(=O)C[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1ccco1 |
| InChI | InChI=1S/C21H30N2O4S/c1-3-4-5-6-7-14-22-21(24)16-19(20-9-8-15-27-20)23-28(25,26)18-12-10-17(2)11-13-18/h8-13,15,19,23H,3-7,14,16H2,1-2H3,(H,22,24)/t19-/m1/s1 |
| InChIKey | WVIGXGAPCQSKOO-LJQANCHMSA-N |
| XLogP | 4.08 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|