C18H24N2O7S — CID 3467487
N-(2,2-dimethoxyethyl)-3-(furan-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]propanamide (PubChem CID 3467487) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-(furan-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]propanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-3-(furan-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 3467487 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-(furan-2-yl)-3-[(4-methoxyphenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(S(=O)(=O)NC(CC(=O)NCC(OC)OC)c2ccco2)cc1 |
| InChI | InChI=1S/C18H24N2O7S/c1-24-13-6-8-14(9-7-13)28(22,23)20-15(16-5-4-10-27-16)11-17(21)19-12-18(25-2)26-3/h4-10,15,18,20H,11-12H2,1-3H3,(H,19,21) |
| InChIKey | UYBDHNMUOUGULG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|