C13H11BrNO5S- — CID 3651126
3-[(4-bromophenyl)sulfonylamino]-3-(furan-2-yl)propanoate (PubChem CID 3651126) has the molecular formula C13H11BrNO5S- and a molecular weight of 373.20 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-3-(furan-2-yl)propanoate.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-3-(furan-2-yl)propanoate |
|---|---|
| PubChem CID | 3651126 |
| Molecular Formula | C13H11BrNO5S- |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-3-(furan-2-yl)propanoate |
| SMILES | O=C([O-])CC(NS(=O)(=O)c1ccc(Br)cc1)c1ccco1 |
| InChI | InChI=1S/C13H12BrNO5S/c14-9-3-5-10(6-4-9)21(18,19)15-11(8-13(16)17)12-2-1-7-20-12/h1-7,11,15H,8H2,(H,16,17)/p-1 |
| InChIKey | UKBZHPSKGDTQKI-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |