C9H9BrNO5S- — CID 2340139
(2R)-2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate (PubChem CID 2340139) has the molecular formula C9H9BrNO5S- and a molecular weight of 323.14 g/mol. Its IUPAC name is (2R)-2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate.
| Compound Name | (2R)-2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 2340139 |
| Molecular Formula | C9H9BrNO5S- |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.94 |
| IUPAC Name | (2R)-2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate |
| SMILES | O=C([O-])[C@@H](CO)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H10BrNO5S/c10-6-1-3-7(4-2-6)17(15,16)11-8(5-12)9(13)14/h1-4,8,11-12H,5H2,(H,13,14)/p-1/t8-/m1/s1 |
| InChIKey | ZNIKCDQUKAIUGM-MRVPVSSYSA-M |
| XLogP | -1.16 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |