C18H19BrN2O6S — CID 55307019
[2-(4-methylanilino)-2-oxoethyl] 2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate (PubChem CID 55307019) has the molecular formula C18H19BrN2O6S and a molecular weight of 471.33 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 55307019 |
| Molecular Formula | C18H19BrN2O6S |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C(CO)NS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C18H19BrN2O6S/c1-12-2-6-14(7-3-12)20-17(23)11-27-18(24)16(10-22)21-28(25,26)15-8-4-13(19)5-9-15/h2-9,16,21-22H,10-11H2,1H3,(H,20,23) |
| InChIKey | RCCCMMOHZFWLSK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |