C11H14N2O6S — CID 7448579
(2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxypropanoic acid (PubChem CID 7448579) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is (2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 7448579 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxypropanoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@H](CO)C(=O)O)cc1 |
| InChI | InChI=1S/C11H14N2O6S/c1-7(15)12-8-2-4-9(5-3-8)20(18,19)13-10(6-14)11(16)17/h2-5,10,13-14H,6H2,1H3,(H,12,15)(H,16,17)/t10-/m1/s1 |
| InChIKey | ORVJASHGTGNBIK-SNVBAGLBSA-N |
| XLogP | -0.63 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |