C14H19N3O6S — CID 119224998
2-[2-[(4-acetamidophenyl)sulfonylamino]propanoylamino]propanoic acid (PubChem CID 119224998) has the molecular formula C14H19N3O6S and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[2-[(4-acetamidophenyl)sulfonylamino]propanoylamino]propanoic acid.
| Compound Name | 2-[2-[(4-acetamidophenyl)sulfonylamino]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 119224998 |
| Molecular Formula | C14H19N3O6S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-[2-[(4-acetamidophenyl)sulfonylamino]propanoylamino]propanoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC(C)C(=O)NC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C14H19N3O6S/c1-8(13(19)15-9(2)14(20)21)17-24(22,23)12-6-4-11(5-7-12)16-10(3)18/h4-9,17H,1-3H3,(H,15,19)(H,16,18)(H,20,21) |
| InChIKey | GLYJLHZANSSYHV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |