C20H33N3O4S — CID 36618447
(2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-(7-methyloctyl)propanamide (PubChem CID 36618447) has the molecular formula C20H33N3O4S and a molecular weight of 411.57 g/mol. Its IUPAC name is (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-(7-methyloctyl)propanamide.
| Compound Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-(7-methyloctyl)propanamide |
|---|---|
| PubChem CID | 36618447 |
| Molecular Formula | C20H33N3O4S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-(7-methyloctyl)propanamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](C)C(=O)NCCCCCCC(C)C)cc1 |
| InChI | InChI=1S/C20H33N3O4S/c1-15(2)9-7-5-6-8-14-21-20(25)16(3)23-28(26,27)19-12-10-18(11-13-19)22-17(4)24/h10-13,15-16,23H,5-9,14H2,1-4H3,(H,21,25)(H,22,24)/t16-/m0/s1 |
| InChIKey | VPZWXDOOSYEING-INIZCTEOSA-N |
| XLogP | 3.03 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|