C20H24FN3O5S — CID 24517742
(2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[3-(2-fluorophenoxy)propyl]propanamide (PubChem CID 24517742) has the molecular formula C20H24FN3O5S and a molecular weight of 437.49 g/mol. Its IUPAC name is (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[3-(2-fluorophenoxy)propyl]propanamide.
| Compound Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[3-(2-fluorophenoxy)propyl]propanamide |
|---|---|
| PubChem CID | 24517742 |
| Molecular Formula | C20H24FN3O5S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[3-(2-fluorophenoxy)propyl]propanamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](C)C(=O)NCCCOc2ccccc2F)cc1 |
| InChI | InChI=1S/C20H24FN3O5S/c1-14(20(26)22-12-5-13-29-19-7-4-3-6-18(19)21)24-30(27,28)17-10-8-16(9-11-17)23-15(2)25/h3-4,6-11,14,24H,5,12-13H2,1-2H3,(H,22,26)(H,23,25)/t14-/m0/s1 |
| InChIKey | ANSDHUGNGXLZGC-AWEZNQCLSA-N |
| XLogP | 2.04 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|