C20H22F3N3O5S — CID 55940319
(2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]propanamide (PubChem CID 55940319) has the molecular formula C20H22F3N3O5S and a molecular weight of 473.47 g/mol. Its IUPAC name is (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]propanamide.
| Compound Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 55940319 |
| Molecular Formula | C20H22F3N3O5S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]propanamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](C)C(=O)NCCOc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H22F3N3O5S/c1-13(26-32(29,30)18-9-5-16(6-10-18)25-14(2)27)19(28)24-11-12-31-17-7-3-15(4-8-17)20(21,22)23/h3-10,13,26H,11-12H2,1-2H3,(H,24,28)(H,25,27)/t13-/m0/s1 |
| InChIKey | BPUUHVWIHRYQFH-ZDUSSCGKSA-N |
| XLogP | 2.53 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|