C21H25F3N2O5S — CID 55940434
(2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide (PubChem CID 55940434) has the molecular formula C21H25F3N2O5S and a molecular weight of 474.50 g/mol. Its IUPAC name is (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide.
| Compound Name | (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 55940434 |
| Molecular Formula | C21H25F3N2O5S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C(=O)NCCOc2ccc(C(F)(F)F)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C21H25F3N2O5S/c1-14(2)19(26-32(28,29)18-10-8-16(30-3)9-11-18)20(27)25-12-13-31-17-6-4-15(5-7-17)21(22,23)24/h4-11,14,19,26H,12-13H2,1-3H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | GGBOWLNROPKVSC-IBGZPJMESA-N |
| XLogP | 3.21 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|