C20H30N2O4S — CID 29261446
(2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide (PubChem CID 29261446) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 29261446 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C(=O)NCCC2=CCCCC2)C(C)C)cc1 |
| InChI | InChI=1S/C20H30N2O4S/c1-15(2)19(20(23)21-14-13-16-7-5-4-6-8-16)22-27(24,25)18-11-9-17(26-3)10-12-18/h7,9-12,15,19,22H,4-6,8,13-14H2,1-3H3,(H,21,23)/t19-/m0/s1 |
| InChIKey | IPHCMVZNFZDQSY-IBGZPJMESA-N |
| XLogP | 3.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|