C22H32N2O6S — CID 55324521
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 55324521) has the molecular formula C22H32N2O6S and a molecular weight of 452.57 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55324521 |
| Molecular Formula | C22H32N2O6S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | COc1ccc(S(=O)(=O)NC(C(=O)OCC(=O)NCCC2=CCCCC2)C(C)C)cc1 |
| InChI | InChI=1S/C22H32N2O6S/c1-16(2)21(24-31(27,28)19-11-9-18(29-3)10-12-19)22(26)30-15-20(25)23-14-13-17-7-5-4-6-8-17/h7,9-12,16,21,24H,4-6,8,13-15H2,1-3H3,(H,23,25) |
| InChIKey | HKTSICNGPQYHOC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|