C20H26Cl2N2O6S — CID 42898664
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(3,4-dichlorophenyl)sulfonylamino]-3-hydroxybutanoate (PubChem CID 42898664) has the molecular formula C20H26Cl2N2O6S and a molecular weight of 493.41 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(3,4-dichlorophenyl)sulfonylamino]-3-hydroxybutanoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(3,4-dichlorophenyl)sulfonylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 42898664 |
| Molecular Formula | C20H26Cl2N2O6S |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(3,4-dichlorophenyl)sulfonylamino]-3-hydroxybutanoate |
| SMILES | CC(O)C(NS(=O)(=O)c1ccc(Cl)c(Cl)c1)C(=O)OCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H26Cl2N2O6S/c1-13(25)19(24-31(28,29)15-7-8-16(21)17(22)11-15)20(27)30-12-18(26)23-10-9-14-5-3-2-4-6-14/h5,7-8,11,13,19,24-25H,2-4,6,9-10,12H2,1H3,(H,23,26) |
| InChIKey | KISAMXYYNQOBGS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|