C24H29ClN2O4S — CID 43870887
2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide (PubChem CID 43870887) has the molecular formula C24H29ClN2O4S and a molecular weight of 477.03 g/mol. Its IUPAC name is 2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide.
| Compound Name | 2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 43870887 |
| Molecular Formula | C24H29ClN2O4S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)NCCC2=CCCCC2)cc1Cl |
| InChI | InChI=1S/C24H29ClN2O4S/c1-31-23-13-12-20(17-21(23)25)32(29,30)27-22(16-19-10-6-3-7-11-19)24(28)26-15-14-18-8-4-2-5-9-18/h3,6-8,10-13,17,22,27H,2,4-5,9,14-16H2,1H3,(H,26,28) |
| InChIKey | ULCHSYCCLSHOEB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|