C25H32N2O4S — CID 43871324
N-[2-(cyclohexen-1-yl)ethyl]-2-[(4-methoxy-3-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 43871324) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(4-methoxy-3-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(4-methoxy-3-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 43871324 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(4-methoxy-3-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)NCCC2=CCCCC2)cc1C |
| InChI | InChI=1S/C25H32N2O4S/c1-19-17-22(13-14-24(19)31-2)32(29,30)27-23(18-21-11-7-4-8-12-21)25(28)26-16-15-20-9-5-3-6-10-20/h4,7-9,11-14,17,23,27H,3,5-6,10,15-16,18H2,1-2H3,(H,26,28) |
| InChIKey | WVXPBOBFWCMEPO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|