C27H36N2O4S — CID 43891180
N-[2-(cyclohexen-1-yl)ethyl]-2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 43891180) has the molecular formula C27H36N2O4S and a molecular weight of 484.66 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 43891180 |
| Molecular Formula | C27H36N2O4S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2-methoxy-5-propan-2-ylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | COc1ccc(C(C)C)cc1S(=O)(=O)NC(Cc1ccccc1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C27H36N2O4S/c1-20(2)23-14-15-25(33-3)26(19-23)34(31,32)29-24(18-22-12-8-5-9-13-22)27(30)28-17-16-21-10-6-4-7-11-21/h5,8-10,12-15,19-20,24,29H,4,6-7,11,16-18H2,1-3H3,(H,28,30) |
| InChIKey | NAFJOFSFAGTMCN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|