C19H28N2O5S — CID 40975736
(2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide (PubChem CID 40975736) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 40975736 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)C(=O)NCCC2=CCCCC2)cc1OC |
| InChI | InChI=1S/C19H28N2O5S/c1-14(19(22)20-12-11-15-7-5-4-6-8-15)21-27(23,24)16-9-10-17(25-2)18(13-16)26-3/h7,9-10,13-14,21H,4-6,8,11-12H2,1-3H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | YXYJLHOPEXTEDK-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|