C16H22N2O4S — CID 25469750
N-[2-(cyclohexen-1-yl)ethyl]-2-methoxy-5-sulfamoylbenzamide (PubChem CID 25469750) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-methoxy-5-sulfamoylbenzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-methoxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 25469750 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-methoxy-5-sulfamoylbenzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C16H22N2O4S/c1-22-15-8-7-13(23(17,20)21)11-14(15)16(19)18-10-9-12-5-3-2-4-6-12/h5,7-8,11H,2-4,6,9-10H2,1H3,(H,18,19)(H2,17,20,21) |
| InChIKey | LVEBGWDFQZUQIA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|